C10H15F2N3S — CID 115735749
1-(2,2-difluoroethyl)-N-(thian-4-yl)pyrazol-3-amine (PubChem CID 115735749) has the molecular formula C10H15F2N3S and a molecular weight of 247.31 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-(thian-4-yl)pyrazol-3-amine.
| Compound Name | 1-(2,2-difluoroethyl)-N-(thian-4-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 115735749 |
| Molecular Formula | C10H15F2N3S |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-(thian-4-yl)pyrazol-3-amine |
| SMILES | FC(F)Cn1ccc(NC2CCSCC2)n1 |
| InChI | InChI=1S/C10H15F2N3S/c11-9(12)7-15-4-1-10(14-15)13-8-2-5-16-6-3-8/h1,4,8-9H,2-3,5-7H2,(H,13,14) |
| InChIKey | IZOPGERVOJPJIP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |