C14H20N6 — CID 107110293
1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]pyrazol-3-amine (PubChem CID 107110293) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]pyrazol-3-amine.
| Compound Name | 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 107110293 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]pyrazol-3-amine |
| SMILES | Cc1cc(N2CCC(n3ccc(N)n3)CC2)nc(C)n1 |
| InChI | InChI=1S/C14H20N6/c1-10-9-14(17-11(2)16-10)19-6-3-12(4-7-19)20-8-5-13(15)18-20/h5,8-9,12H,3-4,6-7H2,1-2H3,(H2,15,18) |
| InChIKey | XHHPYICMRAKMRH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |