C20H23NO3 — CID 10711177
tert-butyl (1R,15S)-8-oxo-11-azatetracyclo[8.6.0.01,15.02,7]hexadeca-2,4,6,9-tetraene-11-carboxylate (PubChem CID 10711177) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is tert-butyl (1R,15S)-8-oxo-11-azatetracyclo[8.6.0.01,15.02,7]hexadeca-2,4,6,9-tetraene-11-carboxylate.
| Compound Name | tert-butyl (1R,15S)-8-oxo-11-azatetracyclo[8.6.0.01,15.02,7]hexadeca-2,4,6,9-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 10711177 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | tert-butyl (1R,15S)-8-oxo-11-azatetracyclo[8.6.0.01,15.02,7]hexadeca-2,4,6,9-tetraene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]2C[C@@]23C1=CC(=O)c1ccccc13 |
| InChI | InChI=1S/C20H23NO3/c1-19(2,3)24-18(23)21-10-6-7-13-12-20(13)15-9-5-4-8-14(15)16(22)11-17(20)21/h4-5,8-9,11,13H,6-7,10,12H2,1-3H3/t13-,20+/m0/s1 |
| InChIKey | FWTJZLUGVUMCMJ-RNODOKPDSA-N |
| XLogP | 4.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |