C16H18N2O3 — CID 10755638
tert-butyl (1S,12R)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carboxylate (PubChem CID 10755638) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is tert-butyl (1S,12R)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carboxylate.
| Compound Name | tert-butyl (1S,12R)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carboxylate |
|---|---|
| PubChem CID | 10755638 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | tert-butyl (1S,12R)-7-oxo-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@]23C1=CC(=O)c1[nH]ccc13 |
| InChI | InChI=1S/C16H18N2O3/c1-15(2,3)21-14(20)18-8-9-7-16(9)10-4-5-17-13(10)11(19)6-12(16)18/h4-6,9,17H,7-8H2,1-3H3/t9-,16-/m0/s1 |
| InChIKey | VNOXJOWMJVAKIK-FVMDXXJSSA-N |
| XLogP | 2.60 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |