C19H21NO4 — CID 10544186
tert-butyl (1R,13S)-6-(hydroxymethyl)-8-oxo-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraene-11-carboxylate (PubChem CID 10544186) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is tert-butyl (1R,13S)-6-(hydroxymethyl)-8-oxo-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraene-11-carboxylate.
| Compound Name | tert-butyl (1R,13S)-6-(hydroxymethyl)-8-oxo-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 10544186 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | tert-butyl (1R,13S)-6-(hydroxymethyl)-8-oxo-11-azatetracyclo[8.4.0.01,13.02,7]tetradeca-2,4,6,9-tetraene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@@]23C1=CC(=O)c1c(CO)cccc13 |
| InChI | InChI=1S/C19H21NO4/c1-18(2,3)24-17(23)20-9-12-8-19(12)13-6-4-5-11(10-21)16(13)14(22)7-15(19)20/h4-7,12,21H,8-10H2,1-3H3/t12-,19-/m1/s1 |
| InChIKey | CLJXEJOILRFACR-CWTRNNRKSA-N |
| XLogP | 2.77 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |