C17H17F3O3 — CID 10711215
ethyl (2E)-2-[(5E)-5-[[3-(trifluoromethyl)phenyl]methylidene]oxolan-2-ylidene]propanoate (PubChem CID 10711215) has the molecular formula C17H17F3O3 and a molecular weight of 326.31 g/mol. Its IUPAC name is ethyl (2E)-2-[(5E)-5-[[3-(trifluoromethyl)phenyl]methylidene]oxolan-2-ylidene]propanoate.
| Compound Name | ethyl (2E)-2-[(5E)-5-[[3-(trifluoromethyl)phenyl]methylidene]oxolan-2-ylidene]propanoate |
|---|---|
| PubChem CID | 10711215 |
| Molecular Formula | C17H17F3O3 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | ethyl (2E)-2-[(5E)-5-[[3-(trifluoromethyl)phenyl]methylidene]oxolan-2-ylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=C1\CC/C(=C\c2cccc(C(F)(F)F)c2)O1 |
| InChI | InChI=1S/C17H17F3O3/c1-3-22-16(21)11(2)15-8-7-14(23-15)10-12-5-4-6-13(9-12)17(18,19)20/h4-6,9-10H,3,7-8H2,1-2H3/b14-10+,15-11+ |
| InChIKey | XXAMIMKVYJEACF-WFYKWJGLSA-N |
| XLogP | 4.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|