2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid

C14H17N3O2 — CID 107112511

IUPAC2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid
SMILESCCc1nc(CC)n(-c2c(C)cccc2C(=O)O)n1
InChIInChI=1S/C14H17N3O2/c1-4-11-15-12(5-2)17(16-11)13-9(3)7-6-8-10(13)14(18)19/h6-8H,4-5H2,1-3H3,(H,18,19)
InChIKeyIJELNAXPZJZKEX-UHFFFAOYSA-N
MW259.31 g/mol
LogP2.40
Rot. Bonds4

About 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid

2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid (PubChem CID 107112511) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid.

Molecular Properties

Compound Name2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid
PubChem CID107112511
Molecular FormulaC14H17N3O2
Molecular Weight259.31 g/mol
Exact Mass259.13
IUPAC Name2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid
SMILESCCc1nc(CC)n(-c2c(C)cccc2C(=O)O)n1
InChIInChI=1S/C14H17N3O2/c1-4-11-15-12(5-2)17(16-11)13-9(3)7-6-8-10(13)14(18)19/h6-8H,4-5H2,1-3H3,(H,18,19)
InChIKeyIJELNAXPZJZKEX-UHFFFAOYSA-N
XLogP2.40
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.31
LogP ≤ 52.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid?
The IUPAC name of 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid (CID 107112511) is 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid.
What is the SMILES notation for 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid?
The canonical SMILES for 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid is CCc1nc(CC)n(-c2c(C)cccc2C(=O)O)n1.
What is the InChIKey of 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid?
The InChIKey is IJELNAXPZJZKEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-4-11-15-12(5-2)17(16-11)13-9(3)7-6-8-10(13)14(18)19/h6-8H,4-5H2,1-3H3,(H,18,19).
What are the key properties of 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid?
2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid has a molecular weight of 259.31 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-diethyl-1,2,4-triazol-1-yl)-3-methylbenzoic acid is sourced from PubChem (CID 107112511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).