C17H22N2O2 — CID 82361319
5-tert-butyl-1-(2-ethyl-6-methylphenyl)pyrazole-4-carboxylic acid (PubChem CID 82361319) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 5-tert-butyl-1-(2-ethyl-6-methylphenyl)pyrazole-4-carboxylic acid.
| Compound Name | 5-tert-butyl-1-(2-ethyl-6-methylphenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82361319 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 5-tert-butyl-1-(2-ethyl-6-methylphenyl)pyrazole-4-carboxylic acid |
| SMILES | CCc1cccc(C)c1-n1ncc(C(=O)O)c1C(C)(C)C |
| InChI | InChI=1S/C17H22N2O2/c1-6-12-9-7-8-11(2)14(12)19-15(17(3,4)5)13(10-18-19)16(20)21/h7-10H,6H2,1-5H3,(H,20,21) |
| InChIKey | ZFPIFWUWXRMDLN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |