C17H17N2O5+ — CID 10711351
(Z)-2-hydroxy-2-methoxy-1-(2-pent-4-enoxycarbonyl-1-benzofuran-3-yl)ethenediazonium (PubChem CID 10711351) has the molecular formula C17H17N2O5+ and a molecular weight of 329.33 g/mol. Its IUPAC name is (Z)-2-hydroxy-2-methoxy-1-(2-pent-4-enoxycarbonyl-1-benzofuran-3-yl)ethenediazonium.
| Compound Name | (Z)-2-hydroxy-2-methoxy-1-(2-pent-4-enoxycarbonyl-1-benzofuran-3-yl)ethenediazonium |
|---|---|
| PubChem CID | 10711351 |
| Molecular Formula | C17H17N2O5+ |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (Z)-2-hydroxy-2-methoxy-1-(2-pent-4-enoxycarbonyl-1-benzofuran-3-yl)ethenediazonium |
| SMILES | C=CCCCOC(=O)c1oc2ccccc2c1/C([N+]#N)=C(\O)OC |
| InChI | InChI=1S/C17H16N2O5/c1-3-4-7-10-23-17(21)15-13(14(19-18)16(20)22-2)11-8-5-6-9-12(11)24-15/h3,5-6,8-9H,1,4,7,10H2,2H3/p+1 |
| InChIKey | JMHNMABTFPIBNF-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|