C17H17NO4 — CID 102336072
methyl 1-pent-4-enoxy-4H-furo[3,4-b]indole-3-carboxylate (PubChem CID 102336072) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl 1-pent-4-enoxy-4H-furo[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-pent-4-enoxy-4H-furo[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 102336072 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl 1-pent-4-enoxy-4H-furo[3,4-b]indole-3-carboxylate |
| SMILES | C=CCCCOc1oc(C(=O)OC)c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C17H17NO4/c1-3-4-7-10-21-17-13-11-8-5-6-9-12(11)18-14(13)15(22-17)16(19)20-2/h3,5-6,8-9,18H,1,4,7,10H2,2H3 |
| InChIKey | ZGGADHINQUBTIH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|