C14H11NO4 — CID 10729818
methyl 3-methyl-4-oxo-5H-furo[3,4-c]quinoline-1-carboxylate (PubChem CID 10729818) has the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. Its IUPAC name is methyl 3-methyl-4-oxo-5H-furo[3,4-c]quinoline-1-carboxylate.
| Compound Name | methyl 3-methyl-4-oxo-5H-furo[3,4-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 10729818 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl 3-methyl-4-oxo-5H-furo[3,4-c]quinoline-1-carboxylate |
| SMILES | COC(=O)c1oc(C)c2c(=O)[nH]c3ccccc3c12 |
| InChI | InChI=1S/C14H11NO4/c1-7-10-11(12(19-7)14(17)18-2)8-5-3-4-6-9(8)15-13(10)16/h3-6H,1-2H3,(H,15,16) |
| InChIKey | JVHOSACKYCFQGN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |