C20H16N4O — CID 10711371
(6-ethyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-phenylmethanone (PubChem CID 10711371) has the molecular formula C20H16N4O and a molecular weight of 328.38 g/mol. Its IUPAC name is (6-ethyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-phenylmethanone.
| Compound Name | (6-ethyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-phenylmethanone |
|---|---|
| PubChem CID | 10711371 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (6-ethyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-phenylmethanone |
| SMILES | CCc1nc(C(=O)c2ccccc2)c2cnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C20H16N4O/c1-2-17-22-18(19(25)14-9-5-3-6-10-14)16-13-21-24(20(16)23-17)15-11-7-4-8-12-15/h3-13H,2H2,1H3 |
| InChIKey | ZXIBOSJIDIMEDP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |