C19H26N4O6P2 — CID 15531093
4,6-bis(diethoxyphosphoryl)-1-phenylpyrazolo[5,4-d]pyrimidine (PubChem CID 15531093) has the molecular formula C19H26N4O6P2 and a molecular weight of 468.39 g/mol. Its IUPAC name is 4,6-bis(diethoxyphosphoryl)-1-phenylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 4,6-bis(diethoxyphosphoryl)-1-phenylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 15531093 |
| Molecular Formula | C19H26N4O6P2 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 4,6-bis(diethoxyphosphoryl)-1-phenylpyrazolo[5,4-d]pyrimidine |
| SMILES | CCOP(=O)(OCC)c1nc(P(=O)(OCC)OCC)c2cnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C19H26N4O6P2/c1-5-26-30(24,27-6-2)18-16-14-20-23(15-12-10-9-11-13-15)17(16)21-19(22-18)31(25,28-7-3)29-8-4/h9-14H,5-8H2,1-4H3 |
| InChIKey | CEJFPWQFEKXBBZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|