C18H23NO5 — CID 10711698
ethyl 1-(1-ethoxy-1,3-dioxobutan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 10711698) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is ethyl 1-(1-ethoxy-1,3-dioxobutan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | ethyl 1-(1-ethoxy-1,3-dioxobutan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 10711698 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | ethyl 1-(1-ethoxy-1,3-dioxobutan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CCOC(=O)C(C(C)=O)C1c2ccccc2CCN1C(=O)OCC |
| InChI | InChI=1S/C18H23NO5/c1-4-23-17(21)15(12(3)20)16-14-9-7-6-8-13(14)10-11-19(16)18(22)24-5-2/h6-9,15-16H,4-5,10-11H2,1-3H3 |
| InChIKey | NVXQOLZTBXUJKU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|