C13H21IO2 — CID 10711877
3-(2-iodo-1-methoxyprop-2-enoxy)-2,3-dimethylhepta-1,6-diene (PubChem CID 10711877) has the molecular formula C13H21IO2 and a molecular weight of 336.21 g/mol. Its IUPAC name is 3-(2-iodo-1-methoxyprop-2-enoxy)-2,3-dimethylhepta-1,6-diene.
| Compound Name | 3-(2-iodo-1-methoxyprop-2-enoxy)-2,3-dimethylhepta-1,6-diene |
|---|---|
| PubChem CID | 10711877 |
| Molecular Formula | C13H21IO2 |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3-(2-iodo-1-methoxyprop-2-enoxy)-2,3-dimethylhepta-1,6-diene |
| SMILES | C=CCCC(C)(OC(OC)C(=C)I)C(=C)C |
| InChI | InChI=1S/C13H21IO2/c1-7-8-9-13(5,10(2)3)16-12(15-6)11(4)14/h7,12H,1-2,4,8-9H2,3,5-6H3 |
| InChIKey | MFQIWFSTEJTTRZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|