C11H11F2N3O2 — CID 107120303
4-(3-amino-2,5-difluorobenzoyl)piperazin-2-one (PubChem CID 107120303) has the molecular formula C11H11F2N3O2 and a molecular weight of 255.22 g/mol. Its IUPAC name is 4-(3-amino-2,5-difluorobenzoyl)piperazin-2-one.
| Compound Name | 4-(3-amino-2,5-difluorobenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 107120303 |
| Molecular Formula | C11H11F2N3O2 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-(3-amino-2,5-difluorobenzoyl)piperazin-2-one |
| SMILES | Nc1cc(F)cc(C(=O)N2CCNC(=O)C2)c1F |
| InChI | InChI=1S/C11H11F2N3O2/c12-6-3-7(10(13)8(14)4-6)11(18)16-2-1-15-9(17)5-16/h3-4H,1-2,5,14H2,(H,15,17) |
| InChIKey | MPVFTRAGYKLLOO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|