C15H11F2N3O — CID 107120616
3-amino-N-[(3-cyanophenyl)methyl]-2,5-difluorobenzamide (PubChem CID 107120616) has the molecular formula C15H11F2N3O and a molecular weight of 287.27 g/mol. Its IUPAC name is 3-amino-N-[(3-cyanophenyl)methyl]-2,5-difluorobenzamide.
| Compound Name | 3-amino-N-[(3-cyanophenyl)methyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 107120616 |
| Molecular Formula | C15H11F2N3O |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-amino-N-[(3-cyanophenyl)methyl]-2,5-difluorobenzamide |
| SMILES | N#Cc1cccc(CNC(=O)c2cc(F)cc(N)c2F)c1 |
| InChI | InChI=1S/C15H11F2N3O/c16-11-5-12(14(17)13(19)6-11)15(21)20-8-10-3-1-2-9(4-10)7-18/h1-6H,8,19H2,(H,20,21) |
| InChIKey | LIFPVPGFMNYREP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|