C16H12F2N2O — CID 82797784
N-[(3-cyanophenyl)methyl]-2,6-difluoro-3-methylbenzamide (PubChem CID 82797784) has the molecular formula C16H12F2N2O and a molecular weight of 286.28 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-2,6-difluoro-3-methylbenzamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-2,6-difluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 82797784 |
| Molecular Formula | C16H12F2N2O |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-2,6-difluoro-3-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NCc2cccc(C#N)c2)c1F |
| InChI | InChI=1S/C16H12F2N2O/c1-10-5-6-13(17)14(15(10)18)16(21)20-9-12-4-2-3-11(7-12)8-19/h2-7H,9H2,1H3,(H,20,21) |
| InChIKey | SSANUOKZLCQFFN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |