C15H10F2N2O — CID 130162116
N-benzyl-4-cyano-2,6-difluorobenzamide (PubChem CID 130162116) has the molecular formula C15H10F2N2O and a molecular weight of 272.25 g/mol. Its IUPAC name is N-benzyl-4-cyano-2,6-difluorobenzamide.
| Compound Name | N-benzyl-4-cyano-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 130162116 |
| Molecular Formula | C15H10F2N2O |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-benzyl-4-cyano-2,6-difluorobenzamide |
| SMILES | N#Cc1cc(F)c(C(=O)NCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C15H10F2N2O/c16-12-6-11(8-18)7-13(17)14(12)15(20)19-9-10-4-2-1-3-5-10/h1-7H,9H2,(H,19,20) |
| InChIKey | NJKIGZJKGITEPS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |