C9H3ClF2N2O2 — CID 107122535
(Z)-3-chloro-3-(2,5-difluoro-3-nitrophenyl)prop-2-enenitrile (PubChem CID 107122535) has the molecular formula C9H3ClF2N2O2 and a molecular weight of 244.58 g/mol. Its IUPAC name is (Z)-3-chloro-3-(2,5-difluoro-3-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-chloro-3-(2,5-difluoro-3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 107122535 |
| Molecular Formula | C9H3ClF2N2O2 |
| Molecular Weight | 244.58 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | (Z)-3-chloro-3-(2,5-difluoro-3-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C=C(\Cl)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C9H3ClF2N2O2/c10-7(1-2-13)6-3-5(11)4-8(9(6)12)14(15)16/h1,3-4H/b7-1- |
| InChIKey | ZUBOHRHWNHIHFW-XFSBKJJWSA-N |
| XLogP | 2.98 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|