C8H2BrF2N3O3 — CID 107122764
3-bromo-5-(2,5-difluoro-3-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 107122764) has the molecular formula C8H2BrF2N3O3 and a molecular weight of 306.02 g/mol. Its IUPAC name is 3-bromo-5-(2,5-difluoro-3-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-bromo-5-(2,5-difluoro-3-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 107122764 |
| Molecular Formula | C8H2BrF2N3O3 |
| Molecular Weight | 306.02 g/mol |
| Exact Mass | 304.92 |
| IUPAC Name | 3-bromo-5-(2,5-difluoro-3-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(F)cc(-c2nc(Br)no2)c1F |
| InChI | InChI=1S/C8H2BrF2N3O3/c9-8-12-7(17-13-8)4-1-3(10)2-5(6(4)11)14(15)16/h1-2H |
| InChIKey | OFEBLAAZJQNMPK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.02 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|