C11H9FN4O4 — CID 107122878
2-amino-6-fluoro-N-(5-methyl-1,2-oxazol-3-yl)-3-nitrobenzamide (PubChem CID 107122878) has the molecular formula C11H9FN4O4 and a molecular weight of 280.22 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-(5-methyl-1,2-oxazol-3-yl)-3-nitrobenzamide.
| Compound Name | 2-amino-6-fluoro-N-(5-methyl-1,2-oxazol-3-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 107122878 |
| Molecular Formula | C11H9FN4O4 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-amino-6-fluoro-N-(5-methyl-1,2-oxazol-3-yl)-3-nitrobenzamide |
| SMILES | Cc1cc(NC(=O)c2c(F)ccc([N+](=O)[O-])c2N)no1 |
| InChI | InChI=1S/C11H9FN4O4/c1-5-4-8(15-20-5)14-11(17)9-6(12)2-3-7(10(9)13)16(18)19/h2-4H,13H2,1H3,(H,14,15,17) |
| InChIKey | CPHFSDAVCWOBMR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|