C16H18N6OS — CID 10712342
2-(4-amino-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl)sulfanylpentanamide (PubChem CID 10712342) has the molecular formula C16H18N6OS and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-(4-amino-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl)sulfanylpentanamide.
| Compound Name | 2-(4-amino-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl)sulfanylpentanamide |
|---|---|
| PubChem CID | 10712342 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-(4-amino-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl)sulfanylpentanamide |
| SMILES | CCCC(Sc1nc(N)c2cnn(-c3ccccc3)c2n1)C(N)=O |
| InChI | InChI=1S/C16H18N6OS/c1-2-6-12(14(18)23)24-16-20-13(17)11-9-19-22(15(11)21-16)10-7-4-3-5-8-10/h3-5,7-9,12H,2,6H2,1H3,(H2,18,23)(H2,17,20,21) |
| InChIKey | FNEUIWSCQPBECN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |