C13H15F2NO5 — CID 107123632
2-(2-methylpropoxy)ethyl 2,6-difluoro-3-nitrobenzoate (PubChem CID 107123632) has the molecular formula C13H15F2NO5 and a molecular weight of 303.26 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl 2,6-difluoro-3-nitrobenzoate.
| Compound Name | 2-(2-methylpropoxy)ethyl 2,6-difluoro-3-nitrobenzoate |
|---|---|
| PubChem CID | 107123632 |
| Molecular Formula | C13H15F2NO5 |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl 2,6-difluoro-3-nitrobenzoate |
| SMILES | CC(C)COCCOC(=O)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C13H15F2NO5/c1-8(2)7-20-5-6-21-13(17)11-9(14)3-4-10(12(11)15)16(18)19/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | FOKVBRFYAOFNGA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|