C18H18F4N2O7 — CID 162127312
ethanol;methyl 3-amino-2,6-difluorobenzoate;methyl 2,6-difluoro-3-nitrobenzoate (PubChem CID 162127312) has the molecular formula C18H18F4N2O7 and a molecular weight of 450.34 g/mol. Its IUPAC name is ethanol;methyl 3-amino-2,6-difluorobenzoate;methyl 2,6-difluoro-3-nitrobenzoate.
| Compound Name | ethanol;methyl 3-amino-2,6-difluorobenzoate;methyl 2,6-difluoro-3-nitrobenzoate |
|---|---|
| PubChem CID | 162127312 |
| Molecular Formula | C18H18F4N2O7 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | ethanol;methyl 3-amino-2,6-difluorobenzoate;methyl 2,6-difluoro-3-nitrobenzoate |
| SMILES | CCO.COC(=O)c1c(F)ccc(N)c1F.COC(=O)c1c(F)ccc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C8H5F2NO4.C8H7F2NO2.C2H6O/c1-15-8(12)6-4(9)2-3-5(7(6)10)11(13)14;1-13-8(12)6-4(9)2-3-5(11)7(6)10;1-2-3/h2-3H,1H3;2-3H,11H2,1H3;3H,2H2,1H3 |
| InChIKey | ZIEZMWQFZWRKPE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|