C8H3ClF2N4O4S — CID 107123857
3-(2,5-difluoro-3-nitrophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride (PubChem CID 107123857) has the molecular formula C8H3ClF2N4O4S and a molecular weight of 324.65 g/mol. Its IUPAC name is 3-(2,5-difluoro-3-nitrophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride.
| Compound Name | 3-(2,5-difluoro-3-nitrophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride |
|---|---|
| PubChem CID | 107123857 |
| Molecular Formula | C8H3ClF2N4O4S |
| Molecular Weight | 324.65 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | 3-(2,5-difluoro-3-nitrophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride |
| SMILES | O=[N+]([O-])c1cc(F)cc(-c2n[nH]c(S(=O)(=O)Cl)n2)c1F |
| InChI | InChI=1S/C8H3ClF2N4O4S/c9-20(18,19)8-12-7(13-14-8)4-1-3(10)2-5(6(4)11)15(16)17/h1-2H,(H,12,13,14) |
| InChIKey | XXWSUEXTJURGTP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.65 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|