C11H9ClFNOS — CID 107125030
1-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluorophenyl)ethanol (PubChem CID 107125030) has the molecular formula C11H9ClFNOS and a molecular weight of 257.72 g/mol. Its IUPAC name is 1-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluorophenyl)ethanol.
| Compound Name | 1-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 107125030 |
| Molecular Formula | C11H9ClFNOS |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 1-(5-chloro-1,3-thiazol-2-yl)-2-(3-fluorophenyl)ethanol |
| SMILES | OC(Cc1cccc(F)c1)c1ncc(Cl)s1 |
| InChI | InChI=1S/C11H9ClFNOS/c12-10-6-14-11(16-10)9(15)5-7-2-1-3-8(13)4-7/h1-4,6,9,15H,5H2 |
| InChIKey | NVNXAMWJODZBRD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |