C10H9ClN4S — CID 107125320
2-(5-chloro-1,3-thiazol-2-yl)-6-cyclopropylpyrimidin-4-amine (PubChem CID 107125320) has the molecular formula C10H9ClN4S and a molecular weight of 252.73 g/mol. Its IUPAC name is 2-(5-chloro-1,3-thiazol-2-yl)-6-cyclopropylpyrimidin-4-amine.
| Compound Name | 2-(5-chloro-1,3-thiazol-2-yl)-6-cyclopropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107125320 |
| Molecular Formula | C10H9ClN4S |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2-(5-chloro-1,3-thiazol-2-yl)-6-cyclopropylpyrimidin-4-amine |
| SMILES | Nc1cc(C2CC2)nc(-c2ncc(Cl)s2)n1 |
| InChI | InChI=1S/C10H9ClN4S/c11-7-4-13-10(16-7)9-14-6(5-1-2-5)3-8(12)15-9/h3-5H,1-2H2,(H2,12,14,15) |
| InChIKey | DOXOIMKDBAWXLY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |