C17H13F3O — CID 107126876
1,2,3,4-tetrahydronaphthalen-2-yl-(3,4,5-trifluorophenyl)methanone (PubChem CID 107126876) has the molecular formula C17H13F3O and a molecular weight of 290.28 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-2-yl-(3,4,5-trifluorophenyl)methanone.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-2-yl-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 107126876 |
| Molecular Formula | C17H13F3O |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-2-yl-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H13F3O/c18-14-8-13(9-15(19)16(14)20)17(21)12-6-5-10-3-1-2-4-11(10)7-12/h1-4,8-9,12H,5-7H2 |
| InChIKey | GBTZOHYUMNMSLH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|