C22H39NO2 — CID 10712789
(3R,4S,6S,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-3-(methoxymethoxy)-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 10712789) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is (3R,4S,6S,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-3-(methoxymethoxy)-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (3R,4S,6S,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-3-(methoxymethoxy)-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 10712789 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | (3R,4S,6S,9aS)-6-[(1E,3E)-deca-1,3-dienyl]-3-(methoxymethoxy)-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | CCCCCC/C=C/C=C/[C@@H]1CCC[C@H]2CC[C@@H](OCOC)[C@H](C)N21 |
| InChI | InChI=1S/C22H39NO2/c1-4-5-6-7-8-9-10-11-13-20-14-12-15-21-16-17-22(25-18-24-3)19(2)23(20)21/h9-11,13,19-22H,4-8,12,14-18H2,1-3H3/b10-9+,13-11+/t19-,20+,21-,22+/m0/s1 |
| InChIKey | WZDZRGZTRFPPAP-BUPQAGNCSA-N |
| XLogP | 5.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|