C20H35NO2 — CID 10947214
(3R,4S,6S,9aS)-3-(methoxymethoxy)-4-methyl-6-[(1E,3E)-octa-1,3-dienyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 10947214) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is (3R,4S,6S,9aS)-3-(methoxymethoxy)-4-methyl-6-[(1E,3E)-octa-1,3-dienyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (3R,4S,6S,9aS)-3-(methoxymethoxy)-4-methyl-6-[(1E,3E)-octa-1,3-dienyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 10947214 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (3R,4S,6S,9aS)-3-(methoxymethoxy)-4-methyl-6-[(1E,3E)-octa-1,3-dienyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | CCCC/C=C/C=C/[C@@H]1CCC[C@H]2CC[C@@H](OCOC)[C@H](C)N21 |
| InChI | InChI=1S/C20H35NO2/c1-4-5-6-7-8-9-11-18-12-10-13-19-14-15-20(23-16-22-3)17(2)21(18)19/h7-9,11,17-20H,4-6,10,12-16H2,1-3H3/b8-7+,11-9+/t17-,18+,19-,20+/m0/s1 |
| InChIKey | QYFCDKKRSDQLTQ-UGTMKWLMSA-N |
| XLogP | 4.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|