C20H33NO2 — CID 11109982
(4aS,6S,8aR)-6-[(1E,3E,5E)-deca-1,3,5-trienyl]-2,2,5-trimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine (PubChem CID 11109982) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (4aS,6S,8aR)-6-[(1E,3E,5E)-deca-1,3,5-trienyl]-2,2,5-trimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine.
| Compound Name | (4aS,6S,8aR)-6-[(1E,3E,5E)-deca-1,3,5-trienyl]-2,2,5-trimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine |
|---|---|
| PubChem CID | 11109982 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (4aS,6S,8aR)-6-[(1E,3E,5E)-deca-1,3,5-trienyl]-2,2,5-trimethyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine |
| SMILES | CCCC/C=C/C=C/C=C/[C@@H]1CC[C@H]2OC(C)(C)OC[C@@H]2N1C |
| InChI | InChI=1S/C20H33NO2/c1-5-6-7-8-9-10-11-12-13-17-14-15-19-18(21(17)4)16-22-20(2,3)23-19/h8-13,17-19H,5-7,14-16H2,1-4H3/b9-8+,11-10+,13-12+/t17-,18+,19-/m1/s1 |
| InChIKey | ZXEDUUHOHDVHKG-WKJMZEHESA-N |
| XLogP | 4.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|