C12H24N2OS — CID 107132650
2-(3,3-dimethylmorpholin-4-yl)-2-(thiolan-3-yl)ethanamine (PubChem CID 107132650) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is 2-(3,3-dimethylmorpholin-4-yl)-2-(thiolan-3-yl)ethanamine.
| Compound Name | 2-(3,3-dimethylmorpholin-4-yl)-2-(thiolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 107132650 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-(3,3-dimethylmorpholin-4-yl)-2-(thiolan-3-yl)ethanamine |
| SMILES | CC1(C)COCCN1C(CN)C1CCSC1 |
| InChI | InChI=1S/C12H24N2OS/c1-12(2)9-15-5-4-14(12)11(7-13)10-3-6-16-8-10/h10-11H,3-9,13H2,1-2H3 |
| InChIKey | UMRMDZBBKJGNJH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |