C14H26N2OS — CID 107132688
2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-(thiolan-3-yl)ethanamine (PubChem CID 107132688) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-(thiolan-3-yl)ethanamine.
| Compound Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-(thiolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 107132688 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-2-(thiolan-3-yl)ethanamine |
| SMILES | NCC(C1CCSC1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C14H26N2OS/c15-9-13(11-5-8-18-10-11)16-6-7-17-14-4-2-1-3-12(14)16/h11-14H,1-10,15H2 |
| InChIKey | SRHQIIJRLJJJRL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |