C15H21NO2 — CID 107137752
7-methoxy-1-(oxan-3-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 107137752) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 7-methoxy-1-(oxan-3-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-methoxy-1-(oxan-3-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 107137752 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 7-methoxy-1-(oxan-3-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1ccc2c(c1)C(C1CCCOC1)NCC2 |
| InChI | InChI=1S/C15H21NO2/c1-17-13-5-4-11-6-7-16-15(14(11)9-13)12-3-2-8-18-10-12/h4-5,9,12,15-16H,2-3,6-8,10H2,1H3 |
| InChIKey | VDYKLTNURWWFEZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |