C15H29N3O3 — CID 107139935
tert-butyl 3-[hydrazinyl(oxan-3-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 107139935) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is tert-butyl 3-[hydrazinyl(oxan-3-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[hydrazinyl(oxan-3-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107139935 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | tert-butyl 3-[hydrazinyl(oxan-3-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(NN)C2CCCOC2)C1 |
| InChI | InChI=1S/C15H29N3O3/c1-15(2,3)21-14(19)18-7-6-11(9-18)13(17-16)12-5-4-8-20-10-12/h11-13,17H,4-10,16H2,1-3H3 |
| InChIKey | CEMCWFHCEFPOHH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|