C8H14BrF2NO2 — CID 107140363
1-bromo-1,1-difluoro-2-methyl-3-morpholin-3-ylpropan-2-ol (PubChem CID 107140363) has the molecular formula C8H14BrF2NO2 and a molecular weight of 274.11 g/mol. Its IUPAC name is 1-bromo-1,1-difluoro-2-methyl-3-morpholin-3-ylpropan-2-ol.
| Compound Name | 1-bromo-1,1-difluoro-2-methyl-3-morpholin-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 107140363 |
| Molecular Formula | C8H14BrF2NO2 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-bromo-1,1-difluoro-2-methyl-3-morpholin-3-ylpropan-2-ol |
| SMILES | CC(O)(CC1COCCN1)C(F)(F)Br |
| InChI | InChI=1S/C8H14BrF2NO2/c1-7(13,8(9,10)11)4-6-5-14-3-2-12-6/h6,12-13H,2-5H2,1H3 |
| InChIKey | CMTOGPGFVPWJSW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|