C13H15BrF3NO — CID 106943968
3-[2-(3-bromo-2,6-difluorophenyl)-2-fluoropropyl]morpholine (PubChem CID 106943968) has the molecular formula C13H15BrF3NO and a molecular weight of 338.17 g/mol. Its IUPAC name is 3-[2-(3-bromo-2,6-difluorophenyl)-2-fluoropropyl]morpholine.
| Compound Name | 3-[2-(3-bromo-2,6-difluorophenyl)-2-fluoropropyl]morpholine |
|---|---|
| PubChem CID | 106943968 |
| Molecular Formula | C13H15BrF3NO |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 3-[2-(3-bromo-2,6-difluorophenyl)-2-fluoropropyl]morpholine |
| SMILES | CC(F)(CC1COCCN1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H15BrF3NO/c1-13(17,6-8-7-19-5-4-18-8)11-10(15)3-2-9(14)12(11)16/h2-3,8,18H,4-7H2,1H3 |
| InChIKey | UHKMMPMTYUUCRR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|