C14H18Cl2FNO — CID 107311248
3-[3-(2,3-dichlorophenyl)-2-fluoro-2-methylpropyl]morpholine (PubChem CID 107311248) has the molecular formula C14H18Cl2FNO and a molecular weight of 306.21 g/mol. Its IUPAC name is 3-[3-(2,3-dichlorophenyl)-2-fluoro-2-methylpropyl]morpholine.
| Compound Name | 3-[3-(2,3-dichlorophenyl)-2-fluoro-2-methylpropyl]morpholine |
|---|---|
| PubChem CID | 107311248 |
| Molecular Formula | C14H18Cl2FNO |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-[3-(2,3-dichlorophenyl)-2-fluoro-2-methylpropyl]morpholine |
| SMILES | CC(F)(Cc1cccc(Cl)c1Cl)CC1COCCN1 |
| InChI | InChI=1S/C14H18Cl2FNO/c1-14(17,8-11-9-19-6-5-18-11)7-10-3-2-4-12(15)13(10)16/h2-4,11,18H,5-9H2,1H3 |
| InChIKey | PHHXVMRHYXNNEB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |