C9H12N2O2S — CID 107142827
2-[3-(thiophen-3-ylamino)azetidin-3-yl]acetic acid (PubChem CID 107142827) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-[3-(thiophen-3-ylamino)azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-(thiophen-3-ylamino)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107142827 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-[3-(thiophen-3-ylamino)azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(Nc2ccsc2)CNC1 |
| InChI | InChI=1S/C9H12N2O2S/c12-8(13)3-9(5-10-6-9)11-7-1-2-14-4-7/h1-2,4,10-11H,3,5-6H2,(H,12,13) |
| InChIKey | AUVGKOZHKSXXFS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |