C11H12F2N2O2 — CID 107142265
2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid (PubChem CID 107142265) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107142265 |
| Molecular Formula | C11H12F2N2O2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(Nc2cc(F)cc(F)c2)CNC1 |
| InChI | InChI=1S/C11H12F2N2O2/c12-7-1-8(13)3-9(2-7)15-11(4-10(16)17)5-14-6-11/h1-3,14-15H,4-6H2,(H,16,17) |
| InChIKey | VDUGOXJKLDHQKV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |