2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid

C11H12F2N2O2 — CID 107142265

IUPAC2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid
SMILESO=C(O)CC1(Nc2cc(F)cc(F)c2)CNC1
InChIInChI=1S/C11H12F2N2O2/c12-7-1-8(13)3-9(2-7)15-11(4-10(16)17)5-14-6-11/h1-3,14-15H,4-6H2,(H,16,17)
InChIKeyVDUGOXJKLDHQKV-UHFFFAOYSA-N
MW242.22 g/mol
LogP1.19
Rot. Bonds4

About 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid

2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid (PubChem CID 107142265) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid.

Molecular Properties

Compound Name2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid
PubChem CID107142265
Molecular FormulaC11H12F2N2O2
Molecular Weight242.22 g/mol
Exact Mass242.09
IUPAC Name2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid
SMILESO=C(O)CC1(Nc2cc(F)cc(F)c2)CNC1
InChIInChI=1S/C11H12F2N2O2/c12-7-1-8(13)3-9(2-7)15-11(4-10(16)17)5-14-6-11/h1-3,14-15H,4-6H2,(H,16,17)
InChIKeyVDUGOXJKLDHQKV-UHFFFAOYSA-N
XLogP1.19
TPSA61.36 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.22
LogP ≤ 51.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid?
The IUPAC name of 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid (CID 107142265) is 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid.
What is the SMILES notation for 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid?
The canonical SMILES for 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid is O=C(O)CC1(Nc2cc(F)cc(F)c2)CNC1.
What is the InChIKey of 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid?
The InChIKey is VDUGOXJKLDHQKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2O2/c12-7-1-8(13)3-9(2-7)15-11(4-10(16)17)5-14-6-11/h1-3,14-15H,4-6H2,(H,16,17).
What are the key properties of 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid?
2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid has a molecular weight of 242.22 g/mol, XLogP of 1.19, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,5-difluoroanilino)azetidin-3-yl]acetic acid is sourced from PubChem (CID 107142265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).