C18H19FN4O4 — CID 10714429
N-[[(5S)-3-[3-fluoro-4-[3-[(E)-methoxyiminomethyl]pyrrol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10714429) has the molecular formula C18H19FN4O4 and a molecular weight of 374.37 g/mol. Its IUPAC name is N-[[(5S)-3-[3-fluoro-4-[3-[(E)-methoxyiminomethyl]pyrrol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[3-fluoro-4-[3-[(E)-methoxyiminomethyl]pyrrol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10714429 |
| Molecular Formula | C18H19FN4O4 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[[(5S)-3-[3-fluoro-4-[3-[(E)-methoxyiminomethyl]pyrrol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CO/N=C/c1ccn(-c2ccc(N3C[C@H](CNC(C)=O)OC3=O)cc2F)c1 |
| InChI | InChI=1S/C18H19FN4O4/c1-12(24)20-9-15-11-23(18(25)27-15)14-3-4-17(16(19)7-14)22-6-5-13(10-22)8-21-26-2/h3-8,10,15H,9,11H2,1-2H3,(H,20,24)/b21-8+/t15-/m0/s1 |
| InChIKey | MFPPNLKSOIKQDE-SJTXTDJHSA-N |
| XLogP | 2.06 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|