C17H20FN5O4 — CID 57254284
N-[[3-[3-fluoro-4-[3-(methoxyiminomethyl)-2H-imidazol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 57254284) has the molecular formula C17H20FN5O4 and a molecular weight of 377.38 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[3-(methoxyiminomethyl)-2H-imidazol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[3-(methoxyiminomethyl)-2H-imidazol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 57254284 |
| Molecular Formula | C17H20FN5O4 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[[3-[3-fluoro-4-[3-(methoxyiminomethyl)-2H-imidazol-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CON=CN1C=CN(c2ccc(N3CC(CNC(C)=O)OC3=O)cc2F)C1 |
| InChI | InChI=1S/C17H20FN5O4/c1-12(24)19-8-14-9-23(17(25)27-14)13-3-4-16(15(18)7-13)22-6-5-21(11-22)10-20-26-2/h3-7,10,14H,8-9,11H2,1-2H3,(H,19,24) |
| InChIKey | SMIDXBUSIKQCGE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|