C10H20N2O — CID 107152437
1-(3,4-dihydro-2H-pyrrol-5-ylamino)-4-methylpentan-2-ol (PubChem CID 107152437) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyrrol-5-ylamino)-4-methylpentan-2-ol.
| Compound Name | 1-(3,4-dihydro-2H-pyrrol-5-ylamino)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 107152437 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyrrol-5-ylamino)-4-methylpentan-2-ol |
| SMILES | CC(C)CC(O)CNC1=NCCC1 |
| InChI | InChI=1S/C10H20N2O/c1-8(2)6-9(13)7-12-10-4-3-5-11-10/h8-9,13H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | FACSYFOEIDGSBN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |