C17H26N2OS — CID 107154300
5-(2,2-dimethylpropyl)-N-(3-phenoxypropyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 107154300) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-N-(3-phenoxypropyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-(2,2-dimethylpropyl)-N-(3-phenoxypropyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107154300 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-N-(3-phenoxypropyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)CC1CN=C(NCCCOc2ccccc2)S1 |
| InChI | InChI=1S/C17H26N2OS/c1-17(2,3)12-15-13-19-16(21-15)18-10-7-11-20-14-8-5-4-6-9-14/h4-6,8-9,15H,7,10-13H2,1-3H3,(H,18,19) |
| InChIKey | CTCZATUYELJQPX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|