C15H30N2S — CID 107154622
5-(2,2-dimethylpropyl)-N-(5-methylhexyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 107154622) has the molecular formula C15H30N2S and a molecular weight of 270.49 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-N-(5-methylhexyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-(2,2-dimethylpropyl)-N-(5-methylhexyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107154622 |
| Molecular Formula | C15H30N2S |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-N-(5-methylhexyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC(C)CCCCNC1=NCC(CC(C)(C)C)S1 |
| InChI | InChI=1S/C15H30N2S/c1-12(2)8-6-7-9-16-14-17-11-13(18-14)10-15(3,4)5/h12-13H,6-11H2,1-5H3,(H,16,17) |
| InChIKey | QKCDYVKZSSZWIA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|