C13H26N4OS — CID 107154673
3-[2-[[5-(2,2-dimethylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]ethyl]-1,1-dimethylurea (PubChem CID 107154673) has the molecular formula C13H26N4OS and a molecular weight of 286.44 g/mol. Its IUPAC name is 3-[2-[[5-(2,2-dimethylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[5-(2,2-dimethylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 107154673 |
| Molecular Formula | C13H26N4OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 3-[2-[[5-(2,2-dimethylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNC1=NCC(CC(C)(C)C)S1 |
| InChI | InChI=1S/C13H26N4OS/c1-13(2,3)8-10-9-16-11(19-10)14-6-7-15-12(18)17(4)5/h10H,6-9H2,1-5H3,(H,14,16)(H,15,18) |
| InChIKey | AZYVPDWRCYKBIY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|