C15H31N3S — CID 107153856
N-[5-(2,2-dimethylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 107153856) has the molecular formula C15H31N3S and a molecular weight of 285.50 g/mol. Its IUPAC name is N-[5-(2,2-dimethylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[5-(2,2-dimethylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107153856 |
| Molecular Formula | C15H31N3S |
| Molecular Weight | 285.50 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-[5-(2,2-dimethylpropyl)-4,5-dihydro-1,3-thiazol-2-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNC1=NCC(CC(C)(C)C)S1 |
| InChI | InChI=1S/C15H31N3S/c1-6-18(7-2)10-8-9-16-14-17-12-13(19-14)11-15(3,4)5/h13H,6-12H2,1-5H3,(H,16,17) |
| InChIKey | XHMZUNCOJFQZDJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|