C11H18FN3O — CID 107154916
1-[(6-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentan-2-ol (PubChem CID 107154916) has the molecular formula C11H18FN3O and a molecular weight of 227.28 g/mol. Its IUPAC name is 1-[(6-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[(6-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107154916 |
| Molecular Formula | C11H18FN3O |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 1-[(6-fluoropyrimidin-4-yl)amino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNc1cc(F)ncn1 |
| InChI | InChI=1S/C11H18FN3O/c1-11(2,3)5-8(16)6-13-10-4-9(12)14-7-15-10/h4,7-8,16H,5-6H2,1-3H3,(H,13,14,15) |
| InChIKey | JOFLLODTDOUALE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |