C12H18F2N2O — CID 107153237
1-[(3,5-difluoro-2-pyridinyl)amino]-4,4-dimethylpentan-2-ol (PubChem CID 107153237) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-[(3,5-difluoro-2-pyridinyl)amino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[(3,5-difluoro-2-pyridinyl)amino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107153237 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1-[(3,5-difluoro-2-pyridinyl)amino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNc1ncc(F)cc1F |
| InChI | InChI=1S/C12H18F2N2O/c1-12(2,3)5-9(17)7-16-11-10(14)4-8(13)6-15-11/h4,6,9,17H,5,7H2,1-3H3,(H,15,16) |
| InChIKey | YZILTBGBEQUKMC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |